24539-72-8 Usage
Description
9H-Xanthene-9-carboxylic acid 2-(diethylamino)ethyl ester is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceuticals. It is characterized by its unique chemical structure, which includes a xanthene core with a carboxylic acid group and a diethylaminoethyl ester functional group. 9H-Xanthene-9-carboxylic acid 2-(diethylamino)ethyl ester plays a significant role in the development of medications targeting specific conditions.
Uses
Used in Pharmaceutical Industry:
9H-Xanthene-9-carboxylic acid 2-(diethylamino)ethyl ester is used as an intermediate in the synthesis of Ulcine Bromide (U700650) for its role in treating overactive bladder syndrome, hypersalivation, and hyperhidrosis. Its chemical structure allows for the development of a strong muscarinic receptor blocking drug, which effectively manages these conditions by reducing involuntary muscle contractions and excessive secretions.
As an intermediate, 9H-Xanthene-9-carboxylic acid 2-(diethylamino)ethyl ester is essential in the production of Ulcine Bromide, which is a potent medication for various ailments related to overactivity and excessive secretions. Its application in the pharmaceutical industry highlights its importance in the development of effective treatments for these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 24539-72-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,5,3 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 24539-72:
(7*2)+(6*4)+(5*5)+(4*3)+(3*9)+(2*7)+(1*2)=118
118 % 10 = 8
So 24539-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H23NO3/c1-3-21(4-2)13-14-23-20(22)19-15-9-5-7-11-17(15)24-18-12-8-6-10-16(18)19/h5-12,19H,3-4,13-14H2,1-2H3