24692-58-8 Usage
Description
N-[N-[1-(Benzyloxycarbonyl)prolyl]valyl]glycine methyl ester, also known as Z-Pro-Val-Gly-OMe, is a chemical compound that is a derivative of the amino acids proline, valine, and glycine. It is commonly used in peptide synthesis and is an important compound in the fields of organic chemistry and biochemistry. N-[N-[1-(Benzyloxycarbonyl)prolyl]valyl]glycine methyl ester is a methyl ester, with a methyl group attached to the carboxyl group of the glycine residue, and features a benzyloxycarbonyl (Z) protecting group that is used to protect the proline residue during peptide synthesis. Z-Pro-Val-Gly-OMe plays a crucial role in the development of new drugs and therapeutic peptides.
Uses
Used in Pharmaceutical Industry:
N-[N-[1-(Benzyloxycarbonyl)prolyl]valyl]glycine methyl ester is used as a building block for the synthesis of peptide-based pharmaceuticals. Its role in creating specific peptide sequences allows for the development of drugs that target various medical conditions.
Used in Research Chemicals:
In the field of biochemistry, Z-Pro-Val-Gly-OMe is used as a research chemical to study the properties and interactions of peptides. This helps scientists understand the mechanisms of peptide action and contributes to the advancement of peptide-related research.
Used in Organic Chemistry:
As a compound with unique structural features, N-[N-[1-(Benzyloxycarbonyl)prolyl]valyl]glycine methyl ester is utilized in organic chemistry for the synthesis of complex organic molecules and the exploration of novel chemical reactions and mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 24692-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,6,9 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 24692-58:
(7*2)+(6*4)+(5*6)+(4*9)+(3*2)+(2*5)+(1*8)=128
128 % 10 = 8
So 24692-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H29N3O6/c1-14(2)18(20(27)22-12-17(25)29-3)23-19(26)16-10-7-11-24(16)21(28)30-13-15-8-5-4-6-9-15/h4-6,8-9,14,16,18H,7,10-13H2,1-3H3,(H,22,27)(H,23,26)