24779-38-2 Usage
Uses
1. Used in Pharmaceutical Industry:
Nigragilline is used as a bioactive compound for its potential therapeutic applications. The expression is: Nigragilline is used as a bioactive compound for its potential therapeutic applications.
2. Used in Research and Development:
Nigragilline is used as a research compound for studying its chemical properties, structure, and potential interactions with other molecules. The expression is: Nigragilline is used as a research compound for studying its chemical properties, structure, and potential interactions with other molecules.
3. Used in Drug Discovery:
Nigragilline may be used as a lead compound in drug discovery, particularly for the development of new therapeutic agents targeting various diseases. The expression is: Nigragilline is used as a lead compound for drug discovery, particularly for the development of new therapeutic agents targeting various diseases.
4. Used in Chemical Synthesis:
Nigragilline can be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in various industries. The expression is: Nigragilline is used as a starting material or intermediate in chemical synthesis for the development of other related compounds with potential applications in various industries.
References
Caesar, Jansson, Mutschler., Pharm. Acta Helv., 44,676 (1969)
Check Digit Verification of cas no
The CAS Registry Mumber 24779-38-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,7,7 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 24779-38:
(7*2)+(6*4)+(5*7)+(4*7)+(3*9)+(2*3)+(1*8)=142
142 % 10 = 2
So 24779-38-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H22N2O/c1-5-6-7-8-13(16)15-10-11(2)14(4)9-12(15)3/h5-8,11-12H,9-10H2,1-4H3/b6-5+,8-7+/t11-,12+/m1/s1
