24910-11-0 Usage
General Description
3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE is a chemical compound with the molecular formula C10H16N2O2. It is a heterocyclic compound that contains a nitrogen and oxygen atom in its structure. 3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE is a type of spiro compound, which has a unique arrangement of atoms where two or more rings share a single atom. 3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE has potential applications in various fields such as pharmaceuticals, agrochemicals, and materials science due to its diverse chemical properties and reactivity. Further research and study are needed to explore its full potential in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 24910-11-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,9,1 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24910-11:
(7*2)+(6*4)+(5*9)+(4*1)+(3*0)+(2*1)+(1*1)=90
90 % 10 = 0
So 24910-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c12-7-5-9(6-8(13)11-7)1-3-10-4-2-9/h10H,1-6H2,(H,11,12,13)