24928-72-1 Usage
Description
(1,2-dithioxo-1,2-ethanediyl)bis(imino-2,1-ethanediyl) dioctanoate is a complex chemical compound characterized by its unique molecular structure. It features two dithioxo-ethanediyl groups linked by an imino-ethanediyl bridge and esterified with two octanoate groups. This intricate arrangement of functional groups and overall molecular geometry endows it with potential applications across various fields, including organic synthesis, materials science, and pharmaceuticals. Further research and analysis are essential to fully explore and harness the capabilities of this sophisticated chemical entity.
Uses
Used in Organic Synthesis:
(1,2-dithioxo-1,2-ethanediyl)bis(imino-2,1-ethanediyl) dioctanoate serves as a versatile building block in organic synthesis, enabling the creation of a wide range of complex organic molecules. Its unique structure allows for various chemical reactions, facilitating the synthesis of novel compounds with potential applications in different industries.
Used in Materials Science:
In the field of materials science, (1,2-dithioxo-1,2-ethanediyl)bis(imino-2,1-ethanediyl) dioctanoate is utilized as a key component in the development of advanced materials. Its distinctive molecular structure contributes to the formation of materials with unique properties, such as enhanced stability, reactivity, or selectivity, which can be employed in various applications, including catalysis, sensors, or energy storage.
Used in Pharmaceutical Industry:
(1,2-dithioxo-1,2-ethanediyl)bis(imino-2,1-ethanediyl) dioctanoate holds promise in the pharmaceutical industry as a potential therapeutic agent or as a component in drug delivery systems. Its complex structure and functional groups may offer novel mechanisms of action or improved drug targeting and release, contributing to the development of innovative treatments for various diseases and conditions.
Further research and analysis are necessary to fully understand the specific properties and reactions of (1,2-dithioxo-1,2-ethanediyl)bis(imino-2,1-ethanediyl) dioctanoate, as well as to explore and optimize its potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 24928-72-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,9,2 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 24928-72:
(7*2)+(6*4)+(5*9)+(4*2)+(3*8)+(2*7)+(1*2)=131
131 % 10 = 1
So 24928-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H40N2O4S2/c1-3-5-7-9-11-13-19(25)27-17-15-23-21(29)22(30)24-16-18-28-20(26)14-12-10-8-6-4-2/h3-18H2,1-2H3,(H,23,29)(H,24,30)