250736-84-6 Usage
Description
O-Acetyl-L-homoserine hydrochloride is an off-white to pale yellow solid that serves as a versatile synthon for the synthesis of L-Homoserine peptides and 3-Amino-2-pyrrolidinones. It is a key compound in the field of organic chemistry and pharmaceuticals, playing a significant role in the development of various biologically active molecules.
Uses
Used in Pharmaceutical Industry:
O-Acetyl-L-homoserine hydrochloride is used as a building block for the synthesis of L-Homoserine peptides, which are essential components in the development of new drugs targeting various diseases. Its role in creating these peptides is crucial for enhancing the therapeutic potential of these molecules.
Additionally, O-Acetyl-L-homoserine hydrochloride is used as a precursor in the synthesis of 3-Amino-2-pyrrolidinones, which are important structural motifs found in a wide range of bioactive compounds, including pharmaceuticals and agrochemicals. The versatility of this compound allows for the creation of diverse molecules with potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 250736-84-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,0,7,3 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 250736-84:
(8*2)+(7*5)+(6*0)+(5*7)+(4*3)+(3*6)+(2*8)+(1*4)=136
136 % 10 = 6
So 250736-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO4.ClH/c1-4(8)11-3-2-5(7)6(9)10;/h5H,2-3,7H2,1H3,(H,9,10);1H/t5-;/m0./s1
