25594-61-0 Usage
Description
Ketone, chloromethyl 2-quinoxalinyl (8CI) is a chemical compound characterized by the presence of both ketone and chloromethyl functional groups attached to a 2-quinoxalinyl ring. It has a chemical formula of C10H7ClN2O and a molecular weight of 200.63 g/mol. Ketone, chloromethyl 2-quinoxalinyl (8CI) is known for its unique structure and reactivity, which makes it a valuable component in various applications.
Uses
Used in Pharmaceutical Synthesis:
Ketone, chloromethyl 2-quinoxalinyl (8CI) is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into complex molecular structures. Its presence in drug molecules can contribute to the development of new therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Development:
In the agrochemical industry, Ketone, chloromethyl 2-quinoxalinyl (8CI) is utilized as a building block for the creation of novel agrochemicals. Its incorporation into these compounds can lead to the development of more effective and targeted pesticides or herbicides, enhancing crop protection and yield.
Used in Organic Chemistry Research:
Ketone, chloromethyl 2-quinoxalinyl (8CI) serves as a reagent in organic chemistry research, particularly for the functionalization of quinoxaline compounds. Its unique properties allow researchers to explore new synthetic pathways and develop innovative chemical reactions.
Used in Material Science:
Due to its unique structure and reactivity, Ketone, chloromethyl 2-quinoxalinyl (8CI) may have potential applications in the development of new materials. Its incorporation into material formulations could lead to advancements in areas such as polymer science, nanotechnology, and material coatings.
Used in Chemical Process Development:
Ketone, chloromethyl 2-quinoxalinyl (8CI) may also be employed in the development of new chemical processes, where its reactivity and functional groups can be leveraged to improve process efficiency, yield, or selectivity in various chemical transformations.
It is important to handle Ketone, chloromethyl 2-quinoxalinyl (8CI) with caution due to its potential health and environmental hazards. Proper safety measures should be taken during its synthesis, use, and disposal to minimize risks.
Check Digit Verification of cas no
The CAS Registry Mumber 25594-61-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,5,9 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25594-61:
(7*2)+(6*5)+(5*5)+(4*9)+(3*4)+(2*6)+(1*1)=130
130 % 10 = 0
So 25594-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7ClN2O/c11-5-10(14)9-6-12-7-3-1-2-4-8(7)13-9/h1-4,6H,5H2
25594-61-0Relevant articles and documents
Discovery of a potent class I selective ketone histone deacetylase inhibitor with antitumor activity in vivo and optimized pharmacokinetic properties
Kinzel, Olaf,Llauger-Bufi, Laura,Pescatore, Giovanna,Rowley, Michael,Schultz-Fademrecht, Carsten,Monteagudo, Edith,Fonsi, Massimiliano,Paz, Odalys Gonzalez,Fiore, Fabrizio,Steinkühler, Christian,Jones, Philip
supporting information; experimental part, p. 3453 - 3456 (2010/03/05)
The optimization of a potent, class I selective ketone HDAC inhibitor is shown. It possesses optimized pharmacokinetic properties in preclinical species, has a clean off-target profile, and is negative in a microbial mutagenicity (Ames) test. In a mouse xenograft model it shows efficacy comparable to that of vorinostat at a 10-fold reduced dose.
