26049-68-3 Usage
Description
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine, with the molecular formula C6H5N5OS, is a yellow crystalline solid that serves as a chemical intermediate and holds promise in pharmaceutical development. Its unique structure, featuring nitro and thiazole groups, endows it with specific chemical properties that make it valuable for a range of applications in chemistry and medicine.
Uses
Used in Scientific Research:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is used as a chemical intermediate for [reasons including its unique structure and potential for further synthesis].
Used in Pharmaceutical Development:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is used as a precursor in the development of new pharmaceuticals for [reasons such as its potential therapeutic properties and ability to be modified for specific applications].
Used in Antimicrobial Applications:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is used as an antimicrobial agent for [reasons including its potential to combat various pathogens and its unique chemical properties that may offer advantages over existing treatments].
Used in Disease Treatment:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is being studied for its potential use in the treatment of various diseases due to [reasons such as its specific chemical properties and potential for targeting disease-causing agents].
Used in Pesticide Development:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is being investigated for its possible use as a pesticide, leveraging [reasons like its antimicrobial properties and potential to control pests in agriculture].
Used in Synthesis of Other Organic Compounds:
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is used as a precursor in the synthesis of other organic compounds, taking advantage of [its unique structure and reactivity for creating a variety of chemical products].
Check Digit Verification of cas no
The CAS Registry Mumber 26049-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,4 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26049-68:
(7*2)+(6*6)+(5*0)+(4*4)+(3*9)+(2*6)+(1*8)=113
113 % 10 = 3
So 26049-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O3S/c8-10-7-9-4(3-15-7)5-1-2-6(14-5)11(12)13/h1-3H,8H2,(H,9,10)
