261762-91-8 Usage
General Description
6-Chloro-2-fluoro-3-methylphenol is a compound with the chemical formula C7H6ClFO. It is a derivative of phenol, and is characterized by the presence of a chlorine atom, a fluorine atom, and a methyl group attached to the phenol ring. This chemical is often used as an intermediate or building block in the synthesis of pharmaceuticals and agrochemicals. It has potential applications in the production of antibacterial and antifungal agents, as well as in the development of herbicides and insecticides. Additionally, it may also be used in the manufacturing of dyes, pigments, and other specialty chemicals. Its unique chemical structure and functional groups make it a valuable and versatile compound in various chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 261762-91-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,1,7,6 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 261762-91:
(8*2)+(7*6)+(6*1)+(5*7)+(4*6)+(3*2)+(2*9)+(1*1)=148
148 % 10 = 8
So 261762-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClFO/c1-4-2-3-5(8)7(10)6(4)9/h2-3,10H,1H3