26326-05-6 Usage
General Description
3-Butene-1,2,3-tricarboxylic acid, also known as tricarballylic acid, is a carboxylic acid compound with three carboxylic acid groups attached to a butene backbone. It is a colorless, odorless crystalline solid that is soluble in water. This chemical is not widely used in commercial or industrial applications, but it has been studied for its potential in various fields such as pharmaceuticals, agriculture, and as a building block for the synthesis of other compounds. Tricarballylic acid has been identified as a potential chelating agent and has demonstrated antimicrobial properties, making it of interest in the development of new drugs and agricultural products. Additionally, it can serve as a starting material in the synthesis of other carboxylic acid compounds for various purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 26326-05-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,3,2 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 26326-05:
(7*2)+(6*6)+(5*3)+(4*2)+(3*6)+(2*0)+(1*5)=96
96 % 10 = 6
So 26326-05-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O6/c1-3(6(10)11)4(7(12)13)2-5(8)9/h4H,1-2H2,(H,8,9)(H,10,11)(H,12,13)/p-3/t4-/m0/s1