26586-27-6 Usage
General Description
3-AMINO-4-PIPERIDIN-1-YL-BENZOIC ACID is a chemical compound that consists of a piperidine ring attached to a benzene ring, with an amino group and a carboxylic acid group also present. It is used in the synthesis of pharmaceutical drugs and acts as a building block for various pharmaceutical compounds. 3-AMINO-4-PIPERIDIN-1-YL-BENZOIC ACID is of interest in the fields of medicinal chemistry and drug discovery due to its potential therapeutic applications. Its structural characteristics make it suitable for the development of drugs targeting specific biological pathways and cellular processes. Additionally, 3-AMINO-4-PIPERIDIN-1-YL-BENZOIC ACID has potential for use in the development of novel treatment options for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 26586-27-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,5,8 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26586-27:
(7*2)+(6*6)+(5*5)+(4*8)+(3*6)+(2*2)+(1*7)=136
136 % 10 = 6
So 26586-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O2/c13-10-8-9(12(15)16)4-5-11(10)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7,13H2,(H,15,16)/p-1