26632-12-2 Usage
Description
2-Hydroxytricosanoic acid is a 2-hydroxy fatty acid that is tricosanoic acid substituted by a hydroxy group at position 2. It is a type of fatty acid with a hydroxyl group attached to the second carbon atom, which gives it unique properties and potential applications in various industries.
Uses
Used in Cosmetics and Personal Care Industry:
2-Hydroxytricosanoic acid is used as an emollient and moisturizing agent for [application reason]. Its hydroxyl group allows it to form hydrogen bonds with water molecules, helping to retain moisture in the skin and providing a smooth, silky feel.
Used in Pharmaceutical Industry:
2-Hydroxytricosanoic acid is used as a pharmaceutical excipient for [application reason]. Its ability to form hydrogen bonds with other molecules can enhance the solubility and stability of active pharmaceutical ingredients, improving their bioavailability and effectiveness.
Used in Food Industry:
2-Hydroxytricosanoic acid is used as a food additive for [application reason]. Its emulsifying and stabilizing properties can improve the texture, consistency, and shelf life of various food products.
Used in Lubricants and Grease Industry:
2-Hydroxytricosanoic acid is used as a lubricant or grease additive for [application reason]. Its hydroxyl group can form strong bonds with metal surfaces, providing excellent adhesion and reducing friction between moving parts.
Used in Polymer and Plastics Industry:
2-Hydroxytricosanoic acid is used as a monomer or additive in the production of polymers and plastics for [application reason]. Its ability to form hydrogen bonds can improve the mechanical properties and thermal stability of the resulting materials.
Check Digit Verification of cas no
The CAS Registry Mumber 26632-12-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,3 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 26632-12:
(7*2)+(6*6)+(5*6)+(4*3)+(3*2)+(2*1)+(1*2)=102
102 % 10 = 2
So 26632-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H46O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(25)26/h22,24H,2-21H2,1H3,(H,25,26)