2666-06-0 Usage
Description
2,6-NAPHTHALENEDICARBOXYLIC ACID, DIPOTASSIUM SALT is a potassium salt derived from 2,6-naphthalenedicarboxylic acid, an organic compound with a naphthalene core and two carboxylic acid groups. It has been characterized using electrospray ionization mass spectrometry in a 3:1 water/methanol solution.
Uses
There are no specific applications mentioned in the provided materials for 2,6-NAPHTHALENEDICARBOXYLIC ACID, DIPOTASSIUM SALT. However, based on its chemical structure and properties, it may have potential uses in various industries such as pharmaceuticals, materials science, or chemical research. Further investigation and research would be required to determine its specific applications and benefits in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 2666-06-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,6 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2666-06:
(6*2)+(5*6)+(4*6)+(3*6)+(2*0)+(1*6)=90
90 % 10 = 0
So 2666-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H8O4.2K/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9;;/h1-6H,(H,13,14)(H,15,16);;/q;2*+1/p-2