26825-89-8 Usage
Description
METHYL 16-BROMOHEXADECANOATE is an omega-functionalized long chain protected carboxylic acid, which serves as a crucial building block for the development of self-assembled monolayer molecules. These molecules have a wide range of applications in various industries due to their unique properties and ability to form stable structures.
Uses
Used in Electronics Industry:
METHYL 16-BROMOHEXADECANOATE is used as a building block for self-assembled monolayer molecules for enhancing the performance of electronic devices. The self-assembled monolayers formed using this compound can improve the stability, durability, and conductivity of electronic components, leading to better device performance and longer lifespan.
Used in Biomedical Applications:
In the biomedical field, METHYL 16-BROMOHEXADECANOATE is used as a component in the development of self-assembled monolayer coatings for medical implants and devices. These coatings can provide improved biocompatibility, reduced immune response, and enhanced resistance to bacterial adhesion, ultimately leading to better patient outcomes and reduced risk of infection.
Used in Nanotechnology:
METHYL 16-BROMOHEXADECANOATE is utilized as a key component in the creation of self-assembled monolayer structures in nanotechnology. These structures can be employed in various applications, such as drug delivery systems, sensors, and catalysts, due to their unique properties and ability to form stable, organized layers at the nanoscale.
Used in Surface Science:
In surface science, METHYL 16-BROMOHEXADECANOATE is used as a building block for self-assembled monolayer molecules to study and manipulate surface properties. These monolayers can be used to create tailored surfaces with specific chemical, physical, and biological properties, which can be applied in various fields, such as materials science, catalysis, and environmental science.
Used in Chemical Synthesis:
METHYL 16-BROMOHEXADECANOATE is also used as a versatile intermediate in the synthesis of various complex organic molecules. Its unique structure allows for further functionalization and modification, making it a valuable starting material for the development of new compounds with potential applications in pharmaceuticals, agrochemicals, and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 26825-89-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,2 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 26825-89:
(7*2)+(6*6)+(5*8)+(4*2)+(3*5)+(2*8)+(1*9)=138
138 % 10 = 8
So 26825-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H33BrO2/c1-20-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18/h2-16H2,1H3
