26898-31-7 Usage
Properties
1. Chemical name: 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 2-propenoic acid
2. Type: Polymer
3. Characteristics: Durable and versatile
4. Form: Likely a plastic or resin
5. Composition: Combination of 2-Propenoic acid, 2-methyl-, butyl ester, methyl 2-methyl-2-propenoate, and 2-propenoic acid
Specific content
1. 2-Propenoic acid, 2-methyl-
2. Butyl ester
3. Polymer with methyl 2-methyl-2-propenoate
4. Industrial and commercial applications
5. Potential uses as coating or adhesive
Check Digit Verification of cas no
The CAS Registry Mumber 26898-31-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,9 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 26898-31:
(7*2)+(6*6)+(5*8)+(4*9)+(3*8)+(2*3)+(1*1)=157
157 % 10 = 7
So 26898-31-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2.C5H8O2.C3H4O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-2-3(4)5/h2,4-6H2,1,3H3;1H2,2-3H3;2H,1H2,(H,4,5)