269396-73-8 Usage
General Description
Fmoc-(R)-3-amino-4-(4-iodo-phenyl)-butyric acid is a specialty chemical, typically used in scientific research, particularly in the field of chemistry. The Fmoc refers to the fluorenylmethyloxycarbonyl protection group, which is used to protect amines in peptide synthesis. The term (R)-3-amino-4-(4-iodo-phenyl)-butyric acid refers to a specific configuration of the molecule, with iodine attached to the phenyl and butyric acid group. This chemical compound can be used in the synthesis of various peptides and other organic compounds. The presence of iodine in the molecule can also facilitate certain chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 269396-73-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 269396-73:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*6)+(2*7)+(1*3)=198
198 % 10 = 8
So 269396-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C25H22INO4/c26-17-11-9-16(10-12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m1/s1