269398-82-5 Usage
General Description
"(R)-3-Amino-4-(3-methylphenyl)butanoic Acid Hydrochloride" is a chemical compound that belongs to the chemical class of organic compounds known as phenylpropanoic acids. It is composed of an amino acid backbone with an additional phenyl group which consists of a methyl residue making it a derivative of the more general class of compounds known as benzene and substituted derivatives, which are aromatic compounds containing one monocyclic ring system made of benzene. The presence of the hydrochloride functionality indicates that this compound can function as a salt and possibly alter the pH balance in a given solution. This chemical can have several uses in research and potentially in medicine and industry due to its structural properties. However, details regarding its specific applications or hazardous effects aren't commonly described.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-82-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 269398-82:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*8)+(1*2)=205
205 % 10 = 5
So 269398-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2.ClH/c1-8-3-2-4-9(5-8)6-10(12)7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H/t10-;/m1./s1
