270062-88-9 Usage
Description
FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID, also known as Fmoc-4-nitro-L-beta-homophenylalanine, is a chemical compound that plays a significant role in the field of organic chemistry and pharmaceuticals. It is characterized by its unique molecular structure, which includes a fluorenylmethoxycarbonyl (Fmoc) group, an amino acid backbone, and a nitrophenyl group. FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID is known for its reactivity and versatility in chemical synthesis, particularly in the creation of complex organic molecules and pharmaceutical compounds.
Uses
Used in Pharmaceutical Synthesis:
FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of complex molecules with specific properties, making it a valuable tool in drug discovery and development.
Used in Organic Chemistry:
In the field of organic chemistry, FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID is used as a reagent for the synthesis of guanidinoglycosides. The compound's innovative use of Mitsunobu conditions and diazabicycloundecene (DBU) enables the formation of novel guanidinoglycoside derivatives with potential applications in various industries.
Used in Research and Development:
FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID is also utilized in research and development laboratories for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties make it an attractive candidate for studying various chemical phenomena and developing new methodologies in organic synthesis.
Used in Drug Delivery Systems:
Similar to gallotannin, FMOC-(S)-3-AMINO-4-(4-NITRO-PHENYL)-BUTYRIC ACID can be employed in the development of drug delivery systems. Its chemical properties and reactivity make it a suitable candidate for the design of targeted drug delivery systems, which can improve the bioavailability and therapeutic outcomes of various pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 270062-88-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 270062-88:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*2)+(2*8)+(1*8)=119
119 % 10 = 9
So 270062-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C25H22N2O6/c28-24(29)14-17(13-16-9-11-18(12-10-16)27(31)32)26-25(30)33-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,17,23H,13-15H2,(H,26,30)(H,28,29)/t17-/m0/s1