270062-94-7 Usage
General Description
FMOC-(S)-3-AMINO-4-(3-METHYL-PHENYL)-BUTYRIC ACID is a chemical compound with a molecular structure that includes an FMOC protecting group, an amino group, and a carboxylic acid. It is commonly used as a building block in the synthesis of peptides and other organic molecules. The FMOC protecting group helps to prevent unwanted reactions during the synthesis process. The presence of the amino and carboxylic acid functional groups allows for the compound to participate in peptide coupling reactions, making it a valuable tool in the field of organic chemistry. Additionally, the 3-methyl-phenyl group provides the compound with specific stereochemical and steric properties that can influence its reactivity and interactions with other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 270062-94-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 270062-94:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*2)+(2*9)+(1*4)=117
117 % 10 = 7
So 270062-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C26H25NO4/c1-17-7-6-8-18(13-17)14-19(15-25(28)29)27-26(30)31-16-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-13,19,24H,14-16H2,1H3,(H,27,30)(H,28,29)/t19-/m0/s1