270596-50-4 Usage
General Description
"(S)-3-AMINO-4-(3-FLUOROPHENYL)BUTANOIC ACID HYDROCHLORIDE is a chemical compound that falls under the category of organic compounds. Its exact molecular structure consists of a fluorophenyl group, butanoic acid group, an amino group, and a hydrochloride group. This specific combination makes it a unique and specialized compound. As with other substances, this chemical certainly bears certain physical and chemical characteristics like its molecular weight, boiling point, melting point, solubility, etc. which are typically concentrated on in laboratory testing and analysis. Details regarding its specific uses or industrial applications are sparse, often because such substances are usually used in very specific scientific research or product formulation. Toxicity, safety measures, handling and storage recommendations for this compound would generally be provided on its Material Safety Data Sheets (MSDS). Its ability to react with other substances or under different conditions would depend on the structure and properties of the compound.
Check Digit Verification of cas no
The CAS Registry Mumber 270596-50-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,5,9 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 270596-50:
(8*2)+(7*7)+(6*0)+(5*5)+(4*9)+(3*6)+(2*5)+(1*0)=154
154 % 10 = 4
So 270596-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12FNO2.ClH/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14;/h1-4,9H,5-6,12H2,(H,13,14);1H/t9-;/m0./s1