271-52-3 Usage
Description
1H-Pyrazolo[4,3-c]pyridine is a heterocyclic compound characterized by the fusion of a pyrazolo and pyridine ring systems. It is a versatile building block in organic synthesis and has potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
1H-Pyrazolo[4,3-c]pyridine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of novel drugs with potential applications in treating a range of diseases.
Used in Chemical Synthesis:
1H-Pyrazolo[4,3-c]pyridine serves as a valuable building block in the synthesis of complex organic molecules. Its reactivity and structural diversity make it a useful component in the creation of new chemical entities with potential applications in various industries.
Used in Research and Development:
Due to its unique chemical properties, 1H-Pyrazolo[4,3-c]pyridine is utilized in research and development for the exploration of new chemical reactions and the discovery of novel compounds with potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals.
In the context of the provided materials, 1H-Pyrazolo[4,3-c]pyridine is not directly mentioned. However,
Check Digit Verification of cas no
The CAS Registry Mumber 271-52-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,7 and 1 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 271-52:
(5*2)+(4*7)+(3*1)+(2*5)+(1*2)=53
53 % 10 = 3
So 271-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3/c1-2-7-3-5-4-8-9-6(1)5/h1-4H,(H,8,9)
