27495-40-5 Usage
Description
(3S,5S)-5-[(1S,2Z,3aβ,10aα,10bα)-Decahydro-2-(2,5-dihydro-3-methoxy-4-methyl-5-oxofuran-2-ylidene)-1α-methyl-2H-furo[3,2-c]pyrrolo[1,2-a]azepin-8α-yl]-4,5-dihydro-3-methylfuran-2(3H)-one is a complex organic compound with a unique molecular structure. It is characterized by its stereochemistry, which includes three stereocenters at the 3S, 5S, and 1S positions. The compound features a decahydro-2H-furo[3,2-c]pyrrolo[1,2-a]azepine core, which is further modified by various functional groups, including a 2,5-dihydro-3-methoxy-4-methyl-5-oxofuran-2-ylidene moiety and a 4,5-dihydro-3-methylfuran-2(3H)-one ring. This intricate structure likely confers specific biological activities and potential applications in various fields.
Uses
1. Used in Pharmaceutical Applications:
(3S,5S)-5-[(1S,2Z,3aβ,10aα,10bα)-Decahydro-2-(2,5-dihydro-3-methoxy-4-methyl-5-oxofuran-2-ylidene)-1α-methyl-2H-furo[3,2-c]pyrrolo[1,2-a]azepin-8α-yl]-4,5-dihydro-3-methylfuran-2(3H)-one is used as a potential therapeutic agent for various diseases due to its complex molecular structure and unique stereochemistry. The compound may exhibit specific interactions with biological targets, such as receptors, enzymes, or other proteins, which could lead to the development of new drugs for the treatment of various conditions.
2. Used in Chemical Research:
(3S,5S)-5-[(1S,2Z,3aβ,10aα,10bα)-Decahydro-2-(2,5-dihydro-3-methoxy-4-methyl-5-oxofuran-2-ylidene)-1α-methyl-2H-furo[3,2-c]pyrrolo[1,2-a]azepin-8α-yl]-4,5-dihydro-3-methylfuran-2(3H)-one can also be utilized in chemical research as a starting material or a building block for the synthesis of other complex organic molecules. Its unique structure and functional groups may provide new insights into the design and synthesis of novel compounds with potential applications in various fields, such as materials science, pharmaceuticals, or agrochemistry.
3. Used in Analytical Chemistry:
The compound's distinct ultraviolet spectrum, with a broad absorption maximum at 305 m/J, can be employed in analytical chemistry for the development of new methods or techniques for the detection, quantification, or analysis of similar compounds. This could be particularly useful in the fields of environmental monitoring, quality control, or drug discovery.
4. Used in Material Science:
The complex structure and stereochemistry of (3S,5S)-5-[(1S,2Z,3aβ,10aα,10bα)-Decahydro-2-(2,5-dihydro-3-methoxy-4-methyl-5-oxofuran-2-ylidene)-1α-methyl-2H-furo[3,2-c]pyrrolo[1,2-a]azepin-8α-yl]-4,5-dihydro-3-methylfuran-2(3H)-one may also find applications in material science, where it could be used to develop new materials with unique properties, such as novel polymers, coatings, or adhesives.
References
Kondo, Satomi.,J. Pharrn. Soc., Japan, 67, 182, 185, 188 (1947)
Structure:
Irie et al., Chern. Pharrn. Bull., 21, 451 (1973)
Check Digit Verification of cas no
The CAS Registry Mumber 27495-40-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,9 and 5 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27495-40:
(7*2)+(6*7)+(5*4)+(4*9)+(3*5)+(2*4)+(1*0)=135
135 % 10 = 5
So 27495-40-5 is a valid CAS Registry Number.
InChI:InChI=1/C23H31NO6/c1-11-10-17(29-22(11)25)14-7-8-15-18-12(2)20(28-16(18)6-5-9-24(14)15)21-19(27-4)13(3)23(26)30-21/h11-12,14-18H,5-10H2,1-4H3/b21-20-/t11-,12-,14-,15-,16+,17-,18+/m0/s1