2792-22-5 Usage
Description
[(3-chlorophenyl)hydrazono]acetonitrilo, also known as 3-CPHTN, is a chemical compound with the molecular formula C8H6ClN3. It is a hydrazone derivative of acetonitrile, synthesized through a condensation reaction between 3-chlorophenyl hydrazine and acetonitrile. This colorless to pale yellow crystalline solid has a melting point of 152-154°C and is characterized by its potential applications in various fields.
Uses
Used in Organic Synthesis:
3-CPHTN is utilized as a reagent in organic synthesis, particularly for the preparation of various heterocyclic compounds. Its unique chemical structure allows it to participate in a range of reactions, contributing to the formation of complex organic molecules.
Used in Coordination Chemistry:
In coordination chemistry, 3-CPHTN serves as a ligand, forming complexes with metal ions. These complexes can exhibit interesting properties and applications, such as in catalysis or as potential therapeutic agents.
Used in Pharmaceutical Applications:
3-CPHTN exhibits potential pharmacological activities, including anti-inflammatory and antifungal properties. Its ability to modulate biological processes suggests that it may have future applications in the development of new drugs, pending further research and validation.
Used in Research and Development:
Due to its unique chemical properties and potential applications, 3-CPHTN is also used in research and development settings. Scientists and chemists employ this compound to explore new reaction pathways, develop novel materials, and investigate its biological and medicinal properties further.
Check Digit Verification of cas no
The CAS Registry Mumber 2792-22-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,9 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2792-22:
(6*2)+(5*7)+(4*9)+(3*2)+(2*2)+(1*2)=95
95 % 10 = 5
So 2792-22-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3/c9-7-2-1-3-8(6-7)12-11-5-4-10/h1-3,5-6,12H/b11-5+
