28410-56-2 Usage
General Description
Poly(acetaldehyde-resorcinol) is a polymer composed of acetaldehyde and resorcinol monomers. It is commonly used as a precursor in the synthesis of resorcinol-formaldehyde (RF) resin, which is a versatile material with applications in adhesives, coatings, and composites. Poly(acetaldehyde-resorcinol) is known for its high tensile strength, thermal stability, and adhesion properties, making it a valuable component in the development of high-performance materials. Its ability to form strong crosslinked networks allows for the creation of durable and long-lasting products, and its chemical structure can be tailored to achieve specific mechanical and thermal properties, making it a versatile and valuable material in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 28410-56-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,4,1 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 28410-56:
(7*2)+(6*8)+(5*4)+(4*1)+(3*0)+(2*5)+(1*6)=102
102 % 10 = 2
So 28410-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6O2.C2H4O/c7-5-2-1-3-6(8)4-5;1-2-3/h1-4,7-8H;2H,1H3
