286959-52-2 Usage
General Description
GlcNAc beta(1-3)GalNAc-alpha-Thr is a glycan structure consisting of N-acetylglucosamine (GlcNAc) linked to N-acetylgalactosamine (GalNAc) through a beta(1-3) glycosidic bond, which in turn is attached to a threonine (Thr) residue through an alpha linkage. This glycan structure is a common component of glycoproteins and proteoglycans, playing crucial roles in cell adhesion, signaling, and immune response. It is also a major determinant of blood group antigens and plays a key role in tissue development, cancer progression, and various pathological conditions. The specific arrangement and modification of GlcNAc beta(1-3)GalNAc-alpha-Thr can have significant implications for its biological function and could serve as a potential target for therapeutic interventions in various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 286959-52-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,6,9,5 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 286959-52:
(8*2)+(7*8)+(6*6)+(5*9)+(4*5)+(3*9)+(2*5)+(1*2)=212
212 % 10 = 2
So 286959-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H35N3O13/c1-6(11(21)18(31)32)33-20-13(23-8(3)27)17(15(29)10(5-25)35-20)36-19-12(22-7(2)26)16(30)14(28)9(4-24)34-19/h6,9-17,19-20,24-25,28-30H,4-5,21H2,1-3H3,(H,22,26)(H,23,27)(H,31,32)/t6-,9+,10+,11+,12+,13+,14-,15+,16-,17-,19+,20+/m1/s1