287917-97-9 Usage
General Description
4-BROMO-1H-PYRAZOLE-5-CARBALDEHYDE is a chemical compound with the molecular formula C5H4BrN3O. It is a white to light yellow solid that is used as an intermediate in the pharmaceutical and agrochemical industries. 4-BROMO-1H-PYRAZOLE-5-CARBALDEHYDE is known for its potential applications in the synthesis of various organic compounds, including pharmaceutical drugs and agricultural chemicals. It possesses a bromo and aldehyde functional group, making it a versatile building block for the synthesis of more complex organic molecules. Additionally, 4-BROMO-1H-PYRAZOLE-5-CARBALDEHYDE is a valuable reagent in organic chemistry and can be used in various transformations to introduce the pyrazole and aldehyde functionality into a wide range of molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 287917-97-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,7,9,1 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 287917-97:
(8*2)+(7*8)+(6*7)+(5*9)+(4*1)+(3*7)+(2*9)+(1*7)=209
209 % 10 = 9
So 287917-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrN2O/c5-3-1-6-7-4(3)2-8/h1-2H,(H,6,7)