289039-34-5 Usage
General Description
5-Chloro-2-Fluorophenetole is a specialized, organic chemical compound that features both chlorine and fluorine elements in its molecular structure. More specifically, it is a derivative of phenetole, which means it has a phenyl group (ring of carbon atoms) attached to an ethoxy group (combination of carbon, hydrogen, and oxygen atoms). The "5-Chloro" denotes the presence of a chlorine atom at the fifth position of the carbon ring, while the "2-Fluoro" corresponds to the position of the fluorine atom. This chemical is primarily used in research and development processes in the field of chemistry as it is usually involved in synthesizing more complex molecules. Its properties, toxicity, and specific applications may vary based on its form and how it is used.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-34-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 289039-34:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*3)+(1*4)=175
175 % 10 = 5
So 289039-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClFO/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5H,2H2,1H3
