28995-89-3 Usage
Appearance
Pale yellow solid
Classification
Nitro compound
Physical properties
Highly explosive, toxic, and chemically reactive
Uses
1. High energy propellant and explosive in military applications
2. Manufacturing of dyes and pigments for vibrant colors
Hazards
1. Carcinogenic
2. Causes severe skin and eye irritation upon contact
3. Hazardous to human health and the environment
Safety
Handle with extreme caution and follow proper safety protocols when working with it.
Check Digit Verification of cas no
The CAS Registry Mumber 28995-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,9,9 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28995-89:
(7*2)+(6*8)+(5*9)+(4*9)+(3*5)+(2*8)+(1*9)=183
183 % 10 = 3
So 28995-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H4N4O8/c15-11(16)6-1-5-2-7(12(17)18)4-9(14(21)22)10(5)8(3-6)13(19)20/h1-4H