29073-26-5 Usage
Description
(2R)-2-[(3R,8aS)-2,3,4,5,6,7,8,8a-octahydro-1H-quinolizin-3-yl]piperidine-1-carbaldehyde is a complex organic compound derived from the roots of Leontice leontopetalurn L. It is characterized by its dextrorotatory nature with a specific rotation of [Q1]D2 + 51.9° (c 0.26, EtOH) and forms a crystalline hydrobromide with a melting point of 275-276°C.
Uses
1. Used in Pharmaceutical Industry:
(2R)-2-[(3R,8aS)-2,3,4,5,6,7,8,8a-octahydro-1H-quinolizin-3-yl]piperidine-1-carbaldehyde is used as an active pharmaceutical ingredient for the development of new drugs targeting various medical conditions. Its unique structure and properties make it a promising candidate for drug discovery and design.
2. Used in Chemical Research:
(2R)-2-[(3R,8aS)-2,3,4,5,6,7,8,8a-octahydro-1H-quinolizin-3-yl]piperid ine-1-carbaldehyde is also utilized in chemical research as a key intermediate for the synthesis of more complex molecules with potential applications in various fields, such as materials science, agrochemistry, and environmental science.
3. Used in Analytical Chemistry:
Due to its unique optical activity and crystalline properties, (2R)-2-[(3R,8aS)-2,3,4,5,6,7,8,8a-octahydro-1H-quinolizin-3-yl]piperidine-1-carbaldehyde can be employed as a chiral reference standard in analytical chemistry for the determination of enantiomeric purity and the study of stereoselective reactions.
4. Used in Material Science:
(2R)-2-[(3R,8aS)-2,3,4,5,6,7,8,8a-octahydro-1H-quinolizin-3-yl]piperid ine-1-carbaldehyde's structural features may also find applications in the development of novel materials with specific properties, such as chiral catalysts, enantioselective sensors, or optically active materials for various industrial applications.
References
Mollov, Ivanov., Tetrahedron, 26, 3805 (1970)
Check Digit Verification of cas no
The CAS Registry Mumber 29073-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,0,7 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29073-26:
(7*2)+(6*9)+(5*0)+(4*7)+(3*3)+(2*2)+(1*6)=115
115 % 10 = 5
So 29073-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H26N2O/c18-12-17-10-4-2-6-15(17)13-7-8-14-5-1-3-9-16(14)11-13/h12-15H,1-11H2/t13-,14+,15-/m1/s1
