292067-84-6 Usage
Description
(Z)-N-(3-(DIMETHYLAMINO)-2-(TRIFLUOROMETHYL)ALLYLIDENE)-N-METHYLMETHANAMINIUM HEXAFLUOROPHOSPHATE is a positively charged molecule with a hexafluorophosphate anion, featuring a dimethylamino group, a trifluoromethyl group, and an allylidene group attached to a central N-methylmethanaminium core. (Z)-N-(3-(DIMETHYLAMINO)-2-(TRIFLUOROMETHYL)ALLYLIDENE)-N-METHYLMETHANAMINIUM HEXAFLUOROPHOSPHATE is highly polar and soluble in polar solvents due to its charged groups, making it a candidate for use in organic synthesis as a reagent or catalyst. The presence of a trifluoromethyl group endows the molecule with unique chemical reactivity, while the hexafluorophosphate anion allows for ionic interactions with other charged species, broadening its potential applications in various chemical processes.
Uses
Used in Organic Synthesis:
(Z)-N-(3-(DIMETHYLAMINO)-2-(TRIFLUOROMETHYL)ALLYLIDENE)-N-METHYLMETHANAMINIUM HEXAFLUOROPHOSPHATE is used as a reagent or catalyst in organic synthesis for its unique chemical reactivity and ability to participate in ionic interactions with other charged species.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (Z)-N-(3-(DIMETHYLAMINO)-2-(TRIFLUOROMETHYL)ALLYLIDENE)-N-METHYLMETHANAMINIUM HEXAFLUOROPHOSPHATE may be utilized as a key intermediate in the synthesis of various drug molecules, leveraging its unique reactivity and solubility properties to facilitate the development of new medications.
Used in Chemical Research:
(Z)-N-(3-(DIMETHYLAMINO)-2-(TRIFLUOROMETHYL)ALLYLIDENE)-N-METHYLMETHANAMINIUM HEXAFLUOROPHOSPHATE is used as a research tool in chemical laboratories to study the effects of its unique structural features on reaction mechanisms and to explore new avenues in chemical synthesis and catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 292067-84-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,2,0,6 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 292067-84:
(8*2)+(7*9)+(6*2)+(5*0)+(4*6)+(3*7)+(2*8)+(1*4)=156
156 % 10 = 6
So 292067-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H14BrN2.F6P/c1-9(2)5-7(8)6-10(3)4;1-7(2,3,4,5)6/h5-6H,1-4H3;/q+1;-1