29312-99-0 Usage
Description
2,5-Dibromonicotinic Acid is an organic compound characterized by the presence of two bromine atoms at the 2nd and 5th positions of the nicotinic acid molecule. It is known for its potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
2,5-Dibromonicotinic Acid is used as a key intermediate in the synthesis of heterocyclic urea derivatives, which are known for their antibacterial properties. These derivatives can be employed in the development of new drugs to combat bacterial infections, particularly those caused by drug-resistant strains.
Used in Chemical Synthesis:
In addition to its pharmaceutical applications, 2,5-Dibromonicotinic Acid can also be utilized in the synthesis of other organic compounds with potential uses in various industries. Its unique structure allows for further chemical modifications, making it a versatile building block for the creation of novel molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 29312-99-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,3,1 and 2 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 29312-99:
(7*2)+(6*9)+(5*3)+(4*1)+(3*2)+(2*9)+(1*9)=120
120 % 10 = 0
So 29312-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)
