29508-48-3 Usage
Chemical structure
A complex molecular structure containing a pyrazolium and an azo group, along with methyl and phenyl groups.
Presence of sulfur
Contains sulfur in the form of methyl sulfate, adding to its chemical complexity.
Usage in organic chemistry
Often used in organic chemistry research and as a reagent in various chemical reactions.
Unique structure
Its unique structure and properties make it valuable in the study of molecular interactions.
Development of synthetic methods
Contributes to the development of new synthetic methods in chemistry.
Application in research
Utilized for understanding molecular interactions and advancing chemical knowledge.
Molecular weight
Approximately 390.49 g/mol (considering the methyl sulfate salt form).
Solubility
Likely soluble in organic solvents such as dimethyl sulfoxide (DMSO) or dimethylformamide (DMF), depending on the specific compound.
Reactivity
Potentially reactive with nucleophiles, electrophiles, or other reactive species, depending on the reaction conditions and the presence of functional groups.
Safety precautions
Due to its complex structure and potential reactivity, appropriate safety measures should be taken when handling this compound, such as wearing gloves, using a fume hood, and following proper disposal protocols.
Check Digit Verification of cas no
The CAS Registry Mumber 29508-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,5,0 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29508-48:
(7*2)+(6*9)+(5*5)+(4*0)+(3*8)+(2*4)+(1*8)=133
133 % 10 = 3
So 29508-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N5.CH4O4S/c1-14-13-19(25(24(14)3)16-9-5-4-6-10-16)22-23-20-15(2)21-18-12-8-7-11-17(18)20;1-5-6(2,3)4/h4-14,22H,1-3H3;1H3,(H,2,3,4)/b23-20-;