295790-49-7 Usage
General Description
5-Fluoro-2-piperidin-4-yl-1H-benzoimidazole is a chemical compound that belongs to the class of benzimidazole derivatives. It is characterized by the presence of a fluorine atom, a piperidine ring, and a benzoimidazole ring in its structure. 5-FLUORO-2-PIPERIDIN-4-YL-1H-BENZOIMIDAZOLE has potential applications in medicinal chemistry, likely as a pharmaceutical agent due to the presence of the benzimidazole group, which has been associated with various biological activities. Additionally, the piperidine ring can also impart specific pharmacological properties to the compound. Overall, the chemical structure of 5-Fluoro-2-piperidin-4-yl-1H-benzoimidazole suggests that it may have potential therapeutic uses and could be of interest for further investigation in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 295790-49-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,5,7,9 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 295790-49:
(8*2)+(7*9)+(6*5)+(5*7)+(4*9)+(3*0)+(2*4)+(1*9)=197
197 % 10 = 7
So 295790-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H14FN3/c13-9-1-2-10-11(7-9)16-12(15-10)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2,(H,15,16)
