29755-00-8 Usage
Description
Methyl 2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranoside, with the CAS number 29755-00-8, is a white solid compound that is primarily utilized in the field of organic synthesis. It is a derivative of beta-D-ribofuranoside, a naturally occurring sugar, with three 4-chlorobenzoyl groups attached to the 2, 3, and 5 positions. This modification enhances its reactivity and compatibility with various organic reactions, making it a valuable intermediate in the synthesis of more complex organic molecules.
Uses
Used in Organic Synthesis:
Methyl 2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranoside is used as an intermediate in organic synthesis for the creation of more complex organic molecules. Its unique structure, featuring the 4-chlorobenzoyl groups, allows for selective reactions and functional group manipulations, which are crucial in the synthesis of target compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Methyl 2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranoside is used as a key building block for the development of novel drugs. Its structural diversity and reactivity make it an attractive candidate for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Chemical Research:
Methyl 2,3,5-tri-O-(4-chlorobenzoyl)-beta-D-ribofuranoside is also employed in chemical research as a model compound to study various reaction mechanisms and to develop new synthetic methodologies. Its unique structure provides an opportunity for researchers to explore innovative approaches in organic chemistry and to gain insights into the reactivity of similar compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 29755-00-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,7,5 and 5 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 29755-00:
(7*2)+(6*9)+(5*7)+(4*5)+(3*5)+(2*0)+(1*0)=138
138 % 10 = 8
So 29755-00-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H21Cl3O8/c1-34-27-23(38-26(33)17-6-12-20(30)13-7-17)22(37-25(32)16-4-10-19(29)11-5-16)21(36-27)14-35-24(31)15-2-8-18(28)9-3-15/h2-13,21-23,27H,14H2,1H3/t21-,22-,23-,27-/m1/s1