29836-40-6 Usage
Description
TREMULACIN, a natural compound derived from the Quillaja saponaria tree, is known for its unique properties and potential applications across various industries. It possesses bioactive characteristics and has been a subject of interest for its potential therapeutic and industrial uses.
Uses
Used in Pharmaceutical Industry:
TREMULACIN is used as a therapeutic agent for the treatment of adenoid cystic carcinoma, a rare and aggressive form of cancer. It is particularly effective when used in conjunction with retinoic acid receptor agonists, enhancing the treatment's efficacy and targeting the cancer cells more effectively.
Additionally, TREMULACIN may have potential applications in other areas of the pharmaceutical industry, such as drug delivery systems or as a component in the development of novel therapeutics. However, further research and development are necessary to fully understand and harness its potential in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 29836-40-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,8,3 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 29836-40:
(7*2)+(6*9)+(5*8)+(4*3)+(3*6)+(2*4)+(1*0)=146
146 % 10 = 6
So 29836-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C27H28O11/c28-14-19-21(30)22(31)23(38-24(32)16-8-2-1-3-9-16)25(37-19)36-18-11-5-4-10-17(18)15-35-26(33)27(34)13-7-6-12-20(27)29/h1-5,7-11,13,19,21-23,25,28,30-31,34H,6,12,14-15H2/t19-,21-,22+,23-,25-,27?/m1/s1