299166-55-5 Usage
General Description
AKOS BBS-00004526 is a chemical compound categorized under the CAS number: 93479-90-8. It is characterized by its systematic name; 4-Methylsulfonyl-2-[(2-nitrophenyl)amino]benzoic acid. AKOS BBS-00004526 has a complex structure, and chemists predominantly use it for various scientific experiments and research purposes. However, the exact properties, uses, and safety measures for this particular chemical are not readily available in public databases and might require further specialized chemical knowledge or research to fully comprehend.
Check Digit Verification of cas no
The CAS Registry Mumber 299166-55-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,9,1,6 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 299166-55:
(8*2)+(7*9)+(6*9)+(5*1)+(4*6)+(3*6)+(2*5)+(1*5)=195
195 % 10 = 5
So 299166-55-5 is a valid CAS Registry Number.
InChI:InChI=1S/C7H10N4O/c8-9-7(12)6-4-2-1-3-5(4)10-11-6/h1-3,8H2,(H,9,12)(H,10,11)