29952-64-5 Usage
Description
DIMETHYL N,N-DIISOPROPYLPHOSPHORAMIDITE, also known as DMDP, is a colorless liquid reagent commonly used in organic chemistry for the efficient phosphorylation of alcohols. It is a phosphitylating agent that plays a crucial role in the synthesis of various chemical compounds.
Uses
Used in Organic Chemistry:
DIMETHYL N,N-DIISOPROPYLPHOSPHORAMIDITE is used as a reagent for the efficient phosphorylation of alcohols, which is essential in the synthesis of various chemical compounds and materials.
Used in Pharmaceutical Industry:
DIMETHYL N,N-DIISOPROPYLPHOSPHORAMIDITE is used as a key intermediate in the synthesis of pharmaceutical compounds, particularly those involving the formation of phosphoester bonds. Its ability to efficiently phosphorylate alcohols makes it a valuable tool in the development of new drugs and therapeutic agents.
Used in Chemical Research:
DIMETHYL N,N-DIISOPROPYLPHOSPHORAMIDITE is used as a research tool in the field of chemical research, where it aids in the investigation of various chemical reactions and mechanisms involving the phosphorylation of alcohols.
Used in Material Science:
DIMETHYL N,N-DIISOPROPYLPHOSPHORAMIDITE is used in the development of new materials with specific properties, such as those requiring phosphoester bonds for their structure or function. Its application in material science contributes to the advancement of various industries, including electronics, energy, and aerospace.
Check Digit Verification of cas no
The CAS Registry Mumber 29952-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,9,5 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 29952-64:
(7*2)+(6*9)+(5*9)+(4*5)+(3*2)+(2*6)+(1*4)=155
155 % 10 = 5
So 29952-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H20NO2P/c1-7(2)9(8(3)4)12(10-5)11-6/h7-8H,1-6H3
