301353-36-6 Usage
General Description
5-PIPERIDIN-1-YLMETHYL-FURAN-2-CARBOXYLIC ACID is a chemical compound that consists of a furan ring with a piperidine and a carboxylic acid functional group attached. It is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and pharmaceutical compounds. 5-PIPERIDIN-1-YLMETHYL-FURAN-2-CARBOXYLIC ACID has been found to possess anti-inflammatory and analgesic properties, making it a potential candidate for the development of new medications for the treatment of pain and inflammation-related conditions. Additionally, its unique structure and functional groups make it a versatile intermediate for the preparation of diverse chemical derivatives and analogs with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 301353-36-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,1,3,5 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 301353-36:
(8*3)+(7*0)+(6*1)+(5*3)+(4*5)+(3*3)+(2*3)+(1*6)=86
86 % 10 = 6
So 301353-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c13-11(14)10-5-4-9(15-10)8-12-6-2-1-3-7-12/h4-5H,1-3,6-8H2,(H,13,14)