30148-26-6 Usage
Description
(2-CHLORO-PHENYL)-(1-METHYL-1H-IMIDAZOL-2-YL)-METHANONE is a chemical compound with the molecular formula C10H8ClN3O. It is a ketone derivative that contains a chloro-phenyl group and a methyl-imidazol-2-yl group. (2-CHLORO-PHENYL)-(1-METHYL-1H-IMIDAZOL-2-YL)-METHANONE is commonly used in pharmaceutical research as a potential drug candidate due to its imidazole ring, which is known to have various biological activities. Additionally, it serves as a building block for the synthesis of other organic compounds. However, it is important to exercise caution when handling this chemical, as it may have potential health hazards and is classified as an irritant.
Uses
Used in Pharmaceutical Research:
(2-CHLORO-PHENYL)-(1-METHYL-1H-IMIDAZOL-2-YL)-METHANONE is used as a potential drug candidate in pharmaceutical research for its imidazole ring, which is known to have various biological activities.
Used in Organic Synthesis:
(2-CHLORO-PHENYL)-(1-METHYL-1H-IMIDAZOL-2-YL)-METHANONE is used as a building block for the synthesis of other organic compounds, contributing to the development of new chemical entities and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 30148-26-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,1,4 and 8 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 30148-26:
(7*3)+(6*0)+(5*1)+(4*4)+(3*8)+(2*2)+(1*6)=76
76 % 10 = 6
So 30148-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H9ClN2O/c1-14-7-6-13-11(14)10(15)8-4-2-3-5-9(8)12/h2-7H,1H3
