301666-92-2 Usage
Description
2-CHLORO-3-METHYLPYRIDINE-4-CARBOXYLIC ACID ETHYL ESTER, also known as Ethyl 2-Chloro-3-methylisonicotinate, is an organic compound with a molecular structure that features a chlorinated and methylated pyridine ring. It is an essential intermediate in the synthesis of various chemical compounds and has potential applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
2-CHLORO-3-METHYLPYRIDINE-4-CARBOXYLIC ACYL ESTER is used as a reagent for the synthesis of thiazolyl-pyridin-amine derivatives, which are known as KDR vascular endothelial growth factor receptor (VEGFR) inhibitors. These inhibitors play a crucial role in the development of anti-cancer drugs, as they target the VEGFR, a protein that is often overexpressed in various types of cancer cells, leading to uncontrolled cell growth and angiogenesis.
Used in Chemical Synthesis:
In the chemical industry, 2-CHLORO-3-METHYLPYRIDINE-4-CARBOXYLIC ACID ETHYL ESTER serves as a key intermediate in the synthesis of various complex organic molecules. Its unique structural features, including the chlorinated and methylated pyridine ring, make it a valuable building block for the development of new compounds with potential applications in various fields, such as materials science, agrochemistry, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 301666-92-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,1,6,6 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 301666-92:
(8*3)+(7*0)+(6*1)+(5*6)+(4*6)+(3*6)+(2*9)+(1*2)=122
122 % 10 = 2
So 301666-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO2/c1-3-13-9(12)7-4-5-11-8(10)6(7)2/h4-5H,3H2,1-2H3
301666-92-2Relevant articles and documents
NITROGEN-CONTAINING HETEROCYCLIC COMPOUNDS AND BENAMIDE COMPOUNDS AND DRUGS CONTAINING THE SAME
-
Example 109, (2010/01/31)
Disclosed are compounds represented by formula (I) which have triglyceride biosynthesis inhibitory activity in the liver and inhibitory activity against the secretion of apolipoprotein B-containing lipoprotein from the liver and particularly have excellent inhibitory activity against the secretion of apolipoprotein B-containing lipoprotein, are free from side effect of accumulation of lipids in the liver, and are useful for the treatment and prevention of hyperlipidemia and arteriosclerotic diseases. In formula (I), R1 and R2 represent alkyl, alkoxy, cycloalkyl, phenyl, alkenyl, alkynyl, or a five- or six-membered saturated or unsaturated heterocyclic ring, or R1 and R2, together with a nitrogen atom to which R1 and R2 are attached, may form a ring; R3 and R4 represent a hydrogen atom, alkyl, a halogen atom, hydroxyl, nitrile, alkoxycarbonyl, alkoxy, or carboxyl; or R2 and R3 may be attached to each other to form -(CH2)m-, -N=CH-, -CH=N-, or -(C1-6 alkyl)C=N-; A, D, E, and G each represent a carbon atom, or any one of A, D, E, and G represents a nitrogen atom with the other three each representing a carbon atom; Q represents a nitrogen atom or a carbon atom; Y represents a group represented by formula (II) wherein X represents a hydrogen atom, group -C(=O)N(R5)R6 or group -C(=O)OR7, R8 is absent or represents a bond, an oxygen atom, a sulfur atom, -SO2-, -SO-, -CH2-CH2-, or - CH=CH-, and R9 and R10 represent a hydrogen atom, alkyl, alkoxy, a halogen atom, or hydroxyl; and Z represents - (CH2)n-, -O-(CH2)i-, or -C(=O)NH-(CH2)i-.
