302604-98-4 Usage
Description
9-METHYL-4,5-DIHYDRO[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE is a heterocyclic organic molecule with a complex molecular structure, belonging to the oxadiazole and cinnoline chemical families. It features a five-membered oxadiazole ring fused to a six-membered cinnoline ring, and the presence of a methyl group at position 9 adds a hydrophobic character to the compound.
Uses
Used in Medicinal Chemistry:
9-METHYL-4,5-DIHYDRO[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE is used as a potential compound in medicinal chemistry for its unique molecular structure and properties that may contribute to the development of new pharmaceutical agents.
Used in Pharmaceutical Research:
In pharmaceutical research, 9-METHYL-4,5-DIHYDRO[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE is utilized as a candidate molecule for further investigation and study to explore its specific properties and potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 302604-98-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,2,6,0 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 302604-98:
(8*3)+(7*0)+(6*2)+(5*6)+(4*0)+(3*4)+(2*9)+(1*8)=104
104 % 10 = 4
So 302604-98-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N4O/c1-5-4-10-11-6-2-3-7-9(8(5)6)13-14-12-7/h4H,2-3H2,1H3
