3030-06-6 Usage
Description
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is an organic compound with a complex chemical structure, characterized by a brown powder appearance. It is derived from the indole family of compounds and features a unique combination of functional groups, including an acetyl group, a bromo group, a chloro group, and an acetate group. These structural features contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is used as an intermediate compound in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a valuable building block for the development of new drugs with specific therapeutic properties.
Used in Chemical Synthesis:
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is used as a starting reagent in the synthesis of other complex organic compounds. For example, it was used in the synthesis of 5,5′-dibromo-4,4′-dichloroindigo, showcasing its utility in creating novel chemical entities with potential applications in various industries.
Used in Research and Development:
Due to its unique chemical properties and structural features, 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is also used in research and development settings. Scientists and researchers can utilize this compound to study its interactions with other molecules, explore its potential applications, and develop new methodologies for its synthesis and use.
Check Digit Verification of cas no
The CAS Registry Mumber 3030-06-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,3 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3030-06:
(6*3)+(5*0)+(4*3)+(3*0)+(2*0)+(1*6)=36
36 % 10 = 6
So 3030-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H9BrClNO3/c1-6(16)15-5-10(18-7(2)17)11-9(15)4-3-8(13)12(11)14/h3-5H,1-2H3
