30426-61-0 Usage
Description
Japonine is a quinolone base found in the leaves of Oxira japonica Thunberg. It forms colorless crystals from MeOH-Et20 and has a chemical structure of 3:6-dimethoxy-1-methyl-2-phenyl-4-quinolone.
Uses
1. Used in Pharmaceutical Industry:
Japonine is used as a potential pharmaceutical compound for its quinolone base structure, which may have various therapeutic applications due to its unique chemical properties.
2. Used in Chemical Research:
Japonine can be utilized as a subject of study in chemical research to understand its properties, reactivity, and potential applications in the development of new compounds or materials.
3. Used in Natural Product Extraction:
Japonine serves as an example of a natural product that can be extracted from plants, such as Oxira japonica Thunberg, for further exploration of its potential uses and benefits.
4. Used in Drug Development:
Given its unique structure, japonine may be used as a starting point for the development of new drugs, particularly in the field of medicinal chemistry, where researchers can modify its structure to target specific diseases or conditions.
5. Used in Analytical Chemistry:
Japonine can be employed as a reference compound in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry, for the identification and quantification of similar compounds in complex mixtures.
References
Ha-Huy-Ke, Luckner, Reisch., Phytochem., 92199 (1970)
Check Digit Verification of cas no
The CAS Registry Mumber 30426-61-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,4,2 and 6 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 30426-61:
(7*3)+(6*0)+(5*4)+(4*2)+(3*6)+(2*6)+(1*1)=80
80 % 10 = 0
So 30426-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H17NO3/c1-19-15-10-9-13(21-2)11-14(15)17(20)18(22-3)16(19)12-7-5-4-6-8-12/h4-11H,1-3H3
30426-61-0Relevant articles and documents
The Chemistry of 2H-3,1-Benzoxazine-2,4(1H)-dione (Isatoic Anhydride). 9. Synthesis of 2-Arylquinoline Alkaloids
Coppola, Gary M.
, p. 727 - 731 (2007/10/02)
A one-step synthesis of N-methyl-2-aryl-4-quinolone alkaloids is described.These compounds are readily prepared from the reaction of an N-methylisatoic anhydride with the lithium enolate of an acetophenone.By this method, the reaction of N-methylisatoic a
