30431-99-3 Usage
Description
Ethyl 4-cyanotetrahydro-2H-pyran-4-carboxylate is an organic compound that serves as a key intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its cyano and carboxylate functional groups, which contribute to its reactivity and potential applications in the chemical and pharmaceutical industries.
Uses
Used in Pharmaceutical Industry:
Ethyl 4-cyanotetrahydro-2H-pyran-4-carboxylate is used as a synthetic intermediate for the preparation of Imidazo[1,2-a]pyridinyl derivatives, which are known as IRAK4 inhibitors. These inhibitors play a crucial role in modulating the immune response and have potential applications in the treatment of various inflammatory and autoimmune diseases.
Used in Chemical Synthesis:
In the chemical synthesis industry, ethyl 4-cyanotetrahydro-2H-pyran-4-carboxylate can be utilized as a building block for the development of novel compounds with diverse applications, such as pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structural features make it a valuable component in the design and synthesis of complex molecular architectures.
Check Digit Verification of cas no
The CAS Registry Mumber 30431-99-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,4,3 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 30431-99:
(7*3)+(6*0)+(5*4)+(4*3)+(3*1)+(2*9)+(1*9)=83
83 % 10 = 3
So 30431-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO3/c1-2-13-8(11)9(7-10)3-5-12-6-4-9/h2-6H2,1H3
30431-99-3Relevant articles and documents
HETEROCYCLIC COMPOUNDS CONTAINING AN INDOLE CORE
-
Page/Page column 81-82, (2011/06/26)
Disclosed are novel compounds which inhibit RSK, methods of making such compounds and pharmaceutical compositions comprising such compounds. Also disclosed are methods of treating RSK2 regulated disorders using compounds of the invention.
