304680-36-2 Usage
Description
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE, also known as 1-Methyl-3-n-octylimidazolium Hexafluorophosphate, is a clear light yellow liquid with unique chemical properties. It is a useful research chemical that has found applications in various fields due to its distinctive characteristics.
Uses
Used in Research and Development:
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a research chemical for [application reason], such as studying its properties, interactions, and potential applications in different industries.
Used in Chemical Synthesis:
In the chemical industry, 3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a reagent or intermediate for [application reason], facilitating the synthesis of various compounds and materials.
Used in Pharmaceutical Development:
3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a pharmaceutical candidate for [application reason], potentially leading to the development of new drugs or therapies.
Used in Material Science:
In the field of material science, 3-METHYL-1-OCTYLIMIDAZOLIUM HEXAFLUOROPHOSPHATE is used as a component in the development of novel materials for [application reason], such as improving the properties of existing materials or creating new ones with specific characteristics.
Conductivity
0.44 mS/cm
Check Digit Verification of cas no
The CAS Registry Mumber 304680-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,4,6,8 and 0 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 304680-36:
(8*3)+(7*0)+(6*4)+(5*6)+(4*8)+(3*0)+(2*3)+(1*6)=122
122 % 10 = 2
So 304680-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N2.F6P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-7(2,3,4,5)6/h10-12H,3-9H2,1-2H3;/q+1;-1