30530-43-9 Usage
General Description
2,4-Diamino-6-(3-fluorophenyl)-1,3,5-triazine is a chemical compound with the molecular formula C9H7N5F. It is a member of the triazine class of compounds and is used in a variety of industrial and research applications. 2,4-Diamino-6-(3-fluorophenyl)-1,3,5-triazine is known for its high stability and strong biological activity, making it useful in the development of pharmaceuticals and agrochemicals. Its unique molecular structure allows it to interact with biological systems in a specific and targeted manner, making it a valuable tool in the study and treatment of various diseases. Additionally, this compound has potential as a building block for the synthesis of new materials and chemical products, further adding to its versatility and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 30530-43-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,5,3 and 0 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 30530-43:
(7*3)+(6*0)+(5*5)+(4*3)+(3*0)+(2*4)+(1*3)=69
69 % 10 = 9
So 30530-43-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8FN5/c10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15)
30530-43-9Relevant articles and documents
ANTICANCER COMPOSITION AND COMPOUND
-
, (2008/06/13)
An anticancer composition containing a compound represented by general formula (I) or a pharmacologically acceptable acid addition salt thereof. In formula (I), R10 and R20 may be the same or different from each other and each represents hydrogen, halogen, amino, aralkylamino, nitro, lower alkyl, lower alkoxy, lower alkoxyalkoxy, lower aralkyloxy or acyl; R30 and R40 may be the same or different from each other and each represents hydrogen, nicotinoyl, benzoyl or lower alkoxy; and n represents 0 or 1.