306935-64-8 Usage
General Description
1-(6-Methoxy-7-methyl-6H-[1,2,5]oxadiazolo[3,4-e]indol-8-yl)ethan-1-one is a chemical compound with a complex and unique structure, containing a fused 6H-oxadiazolo-indole ring system. The compound also contains a methoxy group at the 6-position and a methyl group at the 7-position of the indole ring. It further features an ethanone group attached to the 1-position of the indole ring. 1-(6-METHOXY-7-METHYL-6H-[1,2,5]OXADIAZOLO[3,4-E]INDOL-8-YL)ETHAN-1-ONE may have potential applications in pharmaceutical research and drug development due to its structural novelty and potential pharmacological properties. The exact biological and chemical properties of this compound are yet to be fully elucidated and require further investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 306935-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 306935-64:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*5)+(2*6)+(1*4)=148
148 % 10 = 8
So 306935-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2/c1-9(14-15)10-3-4-12-8-13(16-2)6-5-11(12)7-10/h3-8,15H,1-2H3
