306936-23-2 Usage
Chemical structure
A complex organic compound with a pyrrole ring, a carboxylic acid group, a thioethyl chain with a hydroxyethyl group, a methyl group, and a phenyl group.
Functional groups
Contains a carboxylic acid group (-COOH), a hydroxyl group (-OH), a thioether group (-S), and an aromatic ring (phenyl group).
Potential applications
May be used in pharmaceutical and organic synthesis applications due to its unique structure and functional groups.
Biological activity
Could potentially have biological activity, making it a candidate for further research in drug development.
Building block
May be included as a building block in the synthesis of other organic compounds.
Chelating agent or ligand
The compound's diverse functional groups and potential abilities as a chelating agent or ligand may make it useful in chemical research or industrial processes.
Solubility
The presence of a carboxylic acid group and a hydroxyl group may influence the solubility of the compound in water and other polar solvents.
Reactivity
The compound may exhibit reactivity due to the presence of its functional groups, which can participate in various chemical reactions such as esterification, amide formation, and nucleophilic substitution.
Structural complexity
The presence of a pyrrole ring, a thioethyl chain, a hydroxyethyl group, a methyl group, and a phenyl group adds to the structural complexity of the molecule, which may influence its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 306936-23-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,6,9,3 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 306936-23:
(8*3)+(7*0)+(6*6)+(5*9)+(4*3)+(3*6)+(2*2)+(1*3)=142
142 % 10 = 2
So 306936-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO3S/c1-12-14(16(19)20)11-15(13-5-3-2-4-6-13)17(12)7-9-21-10-8-18/h2-6,11,18H,7-10H2,1H3,(H,19,20)
