309294-12-0 Usage
Explanation
This is the chemical name of the compound, which is also known as troglitazone.
Explanation
Troglitazone belongs to a group of drugs called thiazolidinediones, which share a common chemical structure and mechanism of action.
Explanation
Troglitazone was initially developed to help treat diabetes by addressing insulin resistance in the body.
Explanation
Troglitazone works by increasing the sensitivity of the body's cells to insulin, allowing them to better respond to the hormone and regulate blood sugar levels.
Explanation
Reports of liver toxicity associated with troglitazone use led to its withdrawal from the market in many countries due to potential health risks.
Explanation
Research has shown that troglitazone may have beneficial effects in treating other conditions, such as cancer and neurodegenerative diseases, beyond its initial purpose as an antidiabetic medication.
Explanation
Troglitazone continues to be researched for its potential use in various medical applications, as scientists explore its possible benefits and risks in treating different health conditions.
Classification
Thiazolidinedione class of drugs
Initial purpose
Antidiabetic medication
Mechanism of action
Increases cellular sensitivity to insulin
Safety concerns
Liver toxicity
Potential therapeutic effects
Cancer and neurodegenerative diseases
Current status
Studied in medicinal chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 309294-12-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,9,2,9 and 4 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 309294-12:
(8*3)+(7*0)+(6*9)+(5*2)+(4*9)+(3*4)+(2*1)+(1*2)=140
140 % 10 = 0
So 309294-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10BrNOS/c1-10(12-6-9(13)14-10)7-2-4-8(11)5-3-7/h2-5,12H,6H2,1H3
