31112-90-0 Usage
General Description
(2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid is a chemical compound with the molecular formula C12H8N2O2S. It is a derivative of thiazole and contains both a pyridine and thiazole ring in its structure. (2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid has potential biological activity due to its presence in certain pharmaceuticals and other chemical applications. The acetic acid moiety in the molecule gives it acidic properties, making it suitable for use as a pharmaceutical intermediate or for other chemical syntheses. The compound's structure and potential reactivity make it a subject of interest in the fields of medicinal chemistry and drug development. Overall, (2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid has the potential to be an important building block in the generation of various pharmaceuticals and other useful chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 31112-90-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,1,1 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 31112-90:
(7*3)+(6*1)+(5*1)+(4*1)+(3*2)+(2*9)+(1*0)=60
60 % 10 = 0
So 31112-90-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O2S/c13-9(14)4-8-6-15-10(12-8)7-2-1-3-11-5-7/h1-3,5-6H,4H2,(H,13,14)